C31H29F3N2O5S — CID 160956151
8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-2-pentyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 160956151) has the molecular formula C31H29F3N2O5S and a molecular weight of 598.64 g/mol. Its IUPAC name is 8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-2-pentyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-2-pentyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 160956151 |
| Molecular Formula | C31H29F3N2O5S |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-2-pentyl-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | CCCCCN1CC(C(=O)O)n2c(c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc2=O)S1(=O)=O |
| InChI | InChI=1S/C31H29F3N2O5S/c1-2-3-6-15-35-19-26(30(38)39)36-27(37)18-23(16-21-11-7-10-20-9-4-5-14-25(20)21)28(29(36)42(35,40)41)22-12-8-13-24(17-22)31(32,33)34/h4-5,7-14,17-18,26H,2-3,6,15-16,19H2,1H3,(H,38,39) |
| InChIKey | SWKJPADYWAGXFM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|