C22H30N2O4 — CID 160956703
benzyl (3R)-7-(prop-2-enoylamino)-3-(pyrrolidine-1-carbonyl)heptanoate (PubChem CID 160956703) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is benzyl (3R)-7-(prop-2-enoylamino)-3-(pyrrolidine-1-carbonyl)heptanoate.
| Compound Name | benzyl (3R)-7-(prop-2-enoylamino)-3-(pyrrolidine-1-carbonyl)heptanoate |
|---|---|
| PubChem CID | 160956703 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | benzyl (3R)-7-(prop-2-enoylamino)-3-(pyrrolidine-1-carbonyl)heptanoate |
| SMILES | C=CC(=O)NCCCC[C@H](CC(=O)OCc1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H30N2O4/c1-2-20(25)23-13-7-6-12-19(22(27)24-14-8-9-15-24)16-21(26)28-17-18-10-4-3-5-11-18/h2-5,10-11,19H,1,6-9,12-17H2,(H,23,25)/t19-/m1/s1 |
| InChIKey | SWMDORHNKLPURT-LJQANCHMSA-N |
| XLogP | 2.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|