C29H29BrO — CID 160957428
(9S,13S)-6-bromo-3-methoxy-16,19-dimethyl-11-phenylpentacyclo[11.7.0.01,9.02,7.015,20]icosa-2,4,6,15,17,19-hexaene (PubChem CID 160957428) has the molecular formula C29H29BrO and a molecular weight of 473.45 g/mol. Its IUPAC name is (9S,13S)-6-bromo-3-methoxy-16,19-dimethyl-11-phenylpentacyclo[11.7.0.01,9.02,7.015,20]icosa-2,4,6,15,17,19-hexaene.
| Compound Name | (9S,13S)-6-bromo-3-methoxy-16,19-dimethyl-11-phenylpentacyclo[11.7.0.01,9.02,7.015,20]icosa-2,4,6,15,17,19-hexaene |
|---|---|
| PubChem CID | 160957428 |
| Molecular Formula | C29H29BrO |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (9S,13S)-6-bromo-3-methoxy-16,19-dimethyl-11-phenylpentacyclo[11.7.0.01,9.02,7.015,20]icosa-2,4,6,15,17,19-hexaene |
| SMILES | COc1ccc(Br)c2c1C13c4c(C)ccc(C)c4C[C@@H]1CC(c1ccccc1)C[C@H]3C2 |
| InChI | InChI=1S/C29H29BrO/c1-17-9-10-18(2)27-23(17)15-21-13-20(19-7-5-4-6-8-19)14-22-16-24-25(30)11-12-26(31-3)28(24)29(21,22)27/h4-12,20-22H,13-16H2,1-3H3/t20?,21-,22-,29?/m0/s1 |
| InChIKey | SWOOSKDILLVZPJ-DURLKSDMSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |