C25H23N5O — CID 160958521
5-amino-2,3-dihydroinden-1-one;3-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazole-3,6-diamine (PubChem CID 160958521) has the molecular formula C25H23N5O and a molecular weight of 409.49 g/mol. Its IUPAC name is 5-amino-2,3-dihydroinden-1-one;3-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazole-3,6-diamine.
| Compound Name | 5-amino-2,3-dihydroinden-1-one;3-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazole-3,6-diamine |
|---|---|
| PubChem CID | 160958521 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 5-amino-2,3-dihydroinden-1-one;3-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazole-3,6-diamine |
| SMILES | Nc1ccc2c(c1)CCC2=O.Nc1ccc2c(c1)Cc1c(Nc3ccccc3)n[nH]c1-2 |
| InChI | InChI=1S/C16H14N4.C9H9NO/c17-11-6-7-13-10(8-11)9-14-15(13)19-20-16(14)18-12-4-2-1-3-5-12;10-7-2-3-8-6(5-7)1-4-9(8)11/h1-8H,9,17H2,(H2,18,19,20);2-3,5H,1,4,10H2 |
| InChIKey | SWSCWCXBTGSHDZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|