C36H28N2O2S2 — CID 160958944
2,9-bis(N-ethylanilino)thiochromeno[2,3-b]thioxanthene-7,14-dione (PubChem CID 160958944) has the molecular formula C36H28N2O2S2 and a molecular weight of 584.77 g/mol. Its IUPAC name is 2,9-bis(N-ethylanilino)thiochromeno[2,3-b]thioxanthene-7,14-dione.
| Compound Name | 2,9-bis(N-ethylanilino)thiochromeno[2,3-b]thioxanthene-7,14-dione |
|---|---|
| PubChem CID | 160958944 |
| Molecular Formula | C36H28N2O2S2 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2,9-bis(N-ethylanilino)thiochromeno[2,3-b]thioxanthene-7,14-dione |
| SMILES | CCN(c1ccccc1)c1ccc2sc3cc4c(=O)c5cc(N(CC)c6ccccc6)ccc5sc4cc3c(=O)c2c1 |
| InChI | InChI=1S/C36H28N2O2S2/c1-3-37(23-11-7-5-8-12-23)25-15-17-31-27(19-25)35(39)29-21-34-30(22-33(29)41-31)36(40)28-20-26(16-18-32(28)42-34)38(4-2)24-13-9-6-10-14-24/h5-22H,3-4H2,1-2H3 |
| InChIKey | JNNQNOLDCFETOV-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|