About 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one
3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one (PubChem CID 160959494) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one.
Molecular Properties
| Compound Name | 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one |
| PubChem CID | 160959494 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one |
| SMILES | O=C1Cc2cnc(-c3ccncc3)cc2C1 |
| InChI | InChI=1S/C13H10N2O/c16-12-5-10-7-13(15-8-11(10)6-12)9-1-3-14-4-2-9/h1-4,7-8H,5-6H2 |
| InChIKey | SWVDMCXMAPASJK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one?
The IUPAC name of 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one (CID 160959494) is 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one.
What is the SMILES notation for 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one?
The canonical SMILES for 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one is O=C1Cc2cnc(-c3ccncc3)cc2C1.
What is the InChIKey of 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one?
The InChIKey is SWVDMCXMAPASJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c16-12-5-10-7-13(15-8-11(10)6-12)9-1-3-14-4-2-9/h1-4,7-8H,5-6H2.
What are the key properties of 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one?
3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one has a molecular weight of 210.24 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-yl-5,7-dihydrocyclopenta[c]pyridin-6-one is sourced from PubChem (CID 160959494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).