C12H14O13 — CID 160959715
2-hydroxypropane-1,2,3-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid (PubChem CID 160959715) has the molecular formula C12H14O13 and a molecular weight of 366.23 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 160959715 |
| Molecular Formula | C12H14O13 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)C=C(CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.C6H6O6/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-4(8)1-3(6(11)12)2-5(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H,2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | SWVWMMHJULZFFO-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 244.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|