C22H39ClN2 — CID 160960492
1-[(1-dodecylcyclohexa-2,4-dien-1-yl)methyl]-4,5-dihydro-1H-imidazol-1-ium chloride (PubChem CID 160960492) has the molecular formula C22H39ClN2 and a molecular weight of 367.02 g/mol. Its IUPAC name is 1-[(1-dodecylcyclohexa-2,4-dien-1-yl)methyl]-4,5-dihydro-1H-imidazol-1-ium chloride.
| Compound Name | 1-[(1-dodecylcyclohexa-2,4-dien-1-yl)methyl]-4,5-dihydro-1H-imidazol-1-ium chloride |
|---|---|
| PubChem CID | 160960492 |
| Molecular Formula | C22H39ClN2 |
| Molecular Weight | 367.02 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 1-[(1-dodecylcyclohexa-2,4-dien-1-yl)methyl]-4,5-dihydro-1H-imidazol-1-ium chloride |
| SMILES | CCCCCCCCCCCCC1(C[NH+]2C=NCC2)C=CC=CC1.[Cl-] |
| InChI | InChI=1S/C22H38N2.ClH/c1-2-3-4-5-6-7-8-9-10-12-15-22(16-13-11-14-17-22)20-24-19-18-23-21-24;/h11,13-14,16,21H,2-10,12,15,17-20H2,1H3;1H |
| InChIKey | SWYHDOLDMIXGAJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.02 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|