C15H9Br3F6N2O — CID 160960727
2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline (PubChem CID 160960727) has the molecular formula C15H9Br3F6N2O and a molecular weight of 586.95 g/mol. Its IUPAC name is 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline.
| Compound Name | 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 160960727 |
| Molecular Formula | C15H9Br3F6N2O |
| Molecular Weight | 586.95 g/mol |
| Exact Mass | 583.82 |
| IUPAC Name | 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline |
| SMILES | Nc1c(Br)cc(C(F)(F)F)cc1Br.Nc1c(Br)cc(C(F)(F)F)cc1C=O |
| InChI | InChI=1S/C8H5BrF3NO.C7H4Br2F3N/c9-6-2-5(8(10,11)12)1-4(3-14)7(6)13;8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-3H,13H2;1-2H,13H2 |
| InChIKey | SWYYNDQAYLXQBX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|