About 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline
2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline (PubChem CID 160960727) has the molecular formula C15H9Br3F6N2O
and a molecular weight of 586.95 g/mol. Its IUPAC name is 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline |
| PubChem CID | 160960727 |
| Molecular Formula | C15H9Br3F6N2O |
| Molecular Weight | 586.95 g/mol |
| Exact Mass | 583.82 |
| IUPAC Name | 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline |
| SMILES | Nc1c(Br)cc(C(F)(F)F)cc1Br.Nc1c(Br)cc(C(F)(F)F)cc1C=O |
| InChI | InChI=1S/C8H5BrF3NO.C7H4Br2F3N/c9-6-2-5(8(10,11)12)1-4(3-14)7(6)13;8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-3H,13H2;1-2H,13H2 |
| InChIKey | SWYYNDQAYLXQBX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline?
The IUPAC name of 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline (CID 160960727) is 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline.
What is the SMILES notation for 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline?
The canonical SMILES for 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline is Nc1c(Br)cc(C(F)(F)F)cc1Br.Nc1c(Br)cc(C(F)(F)F)cc1C=O.
What is the InChIKey of 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline?
The InChIKey is SWYYNDQAYLXQBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF3NO.C7H4Br2F3N/c9-6-2-5(8(10,11)12)1-4(3-14)7(6)13;8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-3H,13H2;1-2H,13H2.
What are the key properties of 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline?
2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline has a molecular weight of 586.95 g/mol, XLogP of 6.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-bromo-5-(trifluoromethyl)benzaldehyde;2,6-dibromo-4-(trifluoromethyl)aniline is sourced from PubChem (CID 160960727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).