C23H22N2O3 — CID 160962803
1-(cyclohexanecarbonyl)-2-(3-oxo-1,2-dihydroindol-2-yl)-2H-indol-3-one (PubChem CID 160962803) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-(cyclohexanecarbonyl)-2-(3-oxo-1,2-dihydroindol-2-yl)-2H-indol-3-one.
| Compound Name | 1-(cyclohexanecarbonyl)-2-(3-oxo-1,2-dihydroindol-2-yl)-2H-indol-3-one |
|---|---|
| PubChem CID | 160962803 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-(cyclohexanecarbonyl)-2-(3-oxo-1,2-dihydroindol-2-yl)-2H-indol-3-one |
| SMILES | O=C1c2ccccc2NC1C1C(=O)c2ccccc2N1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H22N2O3/c26-21-15-10-4-6-12-17(15)24-19(21)20-22(27)16-11-5-7-13-18(16)25(20)23(28)14-8-2-1-3-9-14/h4-7,10-14,19-20,24H,1-3,8-9H2 |
| InChIKey | SXFMHVKGQHWDHI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |