C25H34O — CID 160962926
(10R,14S,15S,16S)-14-ethyl-7-methylidenespiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15,2'-oxolane] (PubChem CID 160962926) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is (10R,14S,15S,16S)-14-ethyl-7-methylidenespiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15,2'-oxolane].
| Compound Name | (10R,14S,15S,16S)-14-ethyl-7-methylidenespiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15,2'-oxolane] |
|---|---|
| PubChem CID | 160962926 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (10R,14S,15S,16S)-14-ethyl-7-methylidenespiro[hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadec-5-ene-15,2'-oxolane] |
| SMILES | C=C1C=C2C3CC3C3C(CC[C@@]4(CC)C3C3C[C@@H]3[C@@]43CCCO3)[C@H]2CC1 |
| InChI | InChI=1S/C25H34O/c1-3-24-9-7-16-15-6-5-14(2)11-17(15)18-12-19(18)22(16)23(24)20-13-21(20)25(24)8-4-10-26-25/h11,15-16,18-23H,2-10,12-13H2,1H3/t15-,16?,18?,19?,20?,21+,22?,23?,24+,25+/m1/s1 |
| InChIKey | GQRBSRSEBCDBJL-YYBROQQQSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |