About 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene
1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene (PubChem CID 160963410) has the molecular formula C34H49Cl
and a molecular weight of 493.22 g/mol. Its IUPAC name is 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene |
| PubChem CID | 160963410 |
| Molecular Formula | C34H49Cl |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene |
| SMILES | CCCCCCCCCc1ccc(CC)cc1.CCCc1ccc(Cl)cc1.CCc1ccccc1 |
| InChI | InChI=1S/C17H28.C9H11Cl.C8H10/c1-3-5-6-7-8-9-10-11-17-14-12-16(4-2)13-15-17;1-2-3-8-4-6-9(10)7-5-8;1-2-8-6-4-3-5-7-8/h12-15H,3-11H2,1-2H3;4-7H,2-3H2,1H3;3-7H,2H2,1H3 |
| InChIKey | SXHJXSVQFPMODP-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene?
The IUPAC name of 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene (CID 160963410) is 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene.
What is the SMILES notation for 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene?
The canonical SMILES for 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene is CCCCCCCCCc1ccc(CC)cc1.CCCc1ccc(Cl)cc1.CCc1ccccc1.
What is the InChIKey of 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene?
The InChIKey is SXHJXSVQFPMODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28.C9H11Cl.C8H10/c1-3-5-6-7-8-9-10-11-17-14-12-16(4-2)13-15-17;1-2-3-8-4-6-9(10)7-5-8;1-2-8-6-4-3-5-7-8/h12-15H,3-11H2,1-2H3;4-7H,2-3H2,1H3;3-7H,2H2,1H3.
What are the key properties of 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene?
1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene has a molecular weight of 493.22 g/mol, XLogP of 11.08, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-propylbenzene;ethylbenzene;1-ethyl-4-nonylbenzene is sourced from PubChem (CID 160963410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).