About sodium;sulfuric acid;phenoxide
sodium;sulfuric acid;phenoxide (PubChem CID 160963449) has the molecular formula C6H7NaO5S
and a molecular weight of 214.17 g/mol. Its IUPAC name is sodium;sulfuric acid;phenoxide.
Molecular Properties
| Compound Name | sodium;sulfuric acid;phenoxide |
| PubChem CID | 160963449 |
| Molecular Formula | C6H7NaO5S |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | sodium;sulfuric acid;phenoxide |
| SMILES | O=S(=O)(O)O.[Na+].[O-]c1ccccc1 |
| InChI | InChI=1S/C6H6O.Na.H2O4S/c7-6-4-2-1-3-5-6;;1-5(2,3)4/h1-5,7H;;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | SXHNCAUNUPIMDX-UHFFFAOYSA-M |
| XLogP | -2.89 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;sulfuric acid;phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;sulfuric acid;phenoxide?
The IUPAC name of sodium;sulfuric acid;phenoxide (CID 160963449) is sodium;sulfuric acid;phenoxide.
What is the SMILES notation for sodium;sulfuric acid;phenoxide?
The canonical SMILES for sodium;sulfuric acid;phenoxide is O=S(=O)(O)O.[Na+].[O-]c1ccccc1.
What is the InChIKey of sodium;sulfuric acid;phenoxide?
The InChIKey is SXHNCAUNUPIMDX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O.Na.H2O4S/c7-6-4-2-1-3-5-6;;1-5(2,3)4/h1-5,7H;;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of sodium;sulfuric acid;phenoxide?
sodium;sulfuric acid;phenoxide has a molecular weight of 214.17 g/mol, XLogP of -2.89, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;sulfuric acid;phenoxide is sourced from PubChem (CID 160963449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).