About methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate
methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate (PubChem CID 160963713) has the molecular formula C7H14O3S
and a molecular weight of 178.25 g/mol. Its IUPAC name is methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate.
Molecular Properties
| Compound Name | methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate |
| PubChem CID | 160963713 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate |
| SMILES | C=S(C)CCC(O)C(=O)OC |
| InChI | InChI=1S/C7H14O3S/c1-10-7(9)6(8)4-5-11(2)3/h6,8H,2,4-5H2,1,3H3 |
| InChIKey | GUIYUXMQWPWLII-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate?
The IUPAC name of methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate (CID 160963713) is methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate.
What is the SMILES notation for methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate?
The canonical SMILES for methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate is C=S(C)CCC(O)C(=O)OC.
What is the InChIKey of methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate?
The InChIKey is GUIYUXMQWPWLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3S/c1-10-7(9)6(8)4-5-11(2)3/h6,8H,2,4-5H2,1,3H3.
What are the key properties of methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate?
methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate has a molecular weight of 178.25 g/mol, XLogP of 0.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-4-[methyl(methylidene)-λ4-sulfanyl]butanoate is sourced from PubChem (CID 160963713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).