About sodium;4-fluorobenzaldehyde;methanesulfinate
sodium;4-fluorobenzaldehyde;methanesulfinate (PubChem CID 160964159) has the molecular formula C8H8FNaO3S
and a molecular weight of 226.20 g/mol. Its IUPAC name is sodium;4-fluorobenzaldehyde;methanesulfinate.
Molecular Properties
| Compound Name | sodium;4-fluorobenzaldehyde;methanesulfinate |
| PubChem CID | 160964159 |
| Molecular Formula | C8H8FNaO3S |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | sodium;4-fluorobenzaldehyde;methanesulfinate |
| SMILES | CS(=O)[O-].O=Cc1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C7H5FO.CH4O2S.Na/c8-7-3-1-6(5-9)2-4-7;1-4(2)3;/h1-5H;1H3,(H,2,3);/q;;+1/p-1 |
| InChIKey | SXJWPNXWEBUNOZ-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-fluorobenzaldehyde;methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-fluorobenzaldehyde;methanesulfinate?
The IUPAC name of sodium;4-fluorobenzaldehyde;methanesulfinate (CID 160964159) is sodium;4-fluorobenzaldehyde;methanesulfinate.
What is the SMILES notation for sodium;4-fluorobenzaldehyde;methanesulfinate?
The canonical SMILES for sodium;4-fluorobenzaldehyde;methanesulfinate is CS(=O)[O-].O=Cc1ccc(F)cc1.[Na+].
What is the InChIKey of sodium;4-fluorobenzaldehyde;methanesulfinate?
The InChIKey is SXJWPNXWEBUNOZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5FO.CH4O2S.Na/c8-7-3-1-6(5-9)2-4-7;1-4(2)3;/h1-5H;1H3,(H,2,3);/q;;+1/p-1.
What are the key properties of sodium;4-fluorobenzaldehyde;methanesulfinate?
sodium;4-fluorobenzaldehyde;methanesulfinate has a molecular weight of 226.20 g/mol, XLogP of -1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-fluorobenzaldehyde;methanesulfinate is sourced from PubChem (CID 160964159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).