About 1-benzofuran;bromobenzene
1-benzofuran;bromobenzene (PubChem CID 160964237) has the molecular formula C14H11BrO
and a molecular weight of 275.15 g/mol. Its IUPAC name is 1-benzofuran;bromobenzene.
Molecular Properties
| Compound Name | 1-benzofuran;bromobenzene |
| PubChem CID | 160964237 |
| Molecular Formula | C14H11BrO |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-benzofuran;bromobenzene |
| SMILES | Brc1ccccc1.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C6H5Br/c1-2-4-8-7(3-1)5-6-9-8;7-6-4-2-1-3-5-6/h1-6H;1-5H |
| InChIKey | SXKCDHDYLGKNKZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzofuran;bromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;bromobenzene?
The IUPAC name of 1-benzofuran;bromobenzene (CID 160964237) is 1-benzofuran;bromobenzene.
What is the SMILES notation for 1-benzofuran;bromobenzene?
The canonical SMILES for 1-benzofuran;bromobenzene is Brc1ccccc1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;bromobenzene?
The InChIKey is SXKCDHDYLGKNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C6H5Br/c1-2-4-8-7(3-1)5-6-9-8;7-6-4-2-1-3-5-6/h1-6H;1-5H.
What are the key properties of 1-benzofuran;bromobenzene?
1-benzofuran;bromobenzene has a molecular weight of 275.15 g/mol, XLogP of 4.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;bromobenzene is sourced from PubChem (CID 160964237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).