About azane;nitrourea
azane;nitrourea (PubChem CID 160964499) has the molecular formula CH6N4O3
and a molecular weight of 122.08 g/mol. Its IUPAC name is azane;nitrourea.
Molecular Properties
| Compound Name | azane;nitrourea |
| PubChem CID | 160964499 |
| Molecular Formula | CH6N4O3 |
| Molecular Weight | 122.08 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | azane;nitrourea |
| SMILES | N.NC(=O)N[N+](=O)[O-] |
| InChI | InChI=1S/CH3N3O3.H3N/c2-1(5)3-4(6)7;/h(H3,2,3,5);1H3 |
| InChIKey | SKFPAENRABDQBM-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.08 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;nitrourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;nitrourea?
The IUPAC name of azane;nitrourea (CID 160964499) is azane;nitrourea.
What is the SMILES notation for azane;nitrourea?
The canonical SMILES for azane;nitrourea is N.NC(=O)N[N+](=O)[O-].
What is the InChIKey of azane;nitrourea?
The InChIKey is SKFPAENRABDQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3N3O3.H3N/c2-1(5)3-4(6)7;/h(H3,2,3,5);1H3.
What are the key properties of azane;nitrourea?
azane;nitrourea has a molecular weight of 122.08 g/mol, XLogP of -0.99, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;nitrourea is sourced from PubChem (CID 160964499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).