C22H33N3O9S2 — CID 160965758
(2,5-dioxopyrrolidin-1-yl) 2-[9-[2-[4-(4-aminodithiolan-4-yl)butylamino]-2-oxoethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]acetate (PubChem CID 160965758) has the molecular formula C22H33N3O9S2 and a molecular weight of 547.65 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[9-[2-[4-(4-aminodithiolan-4-yl)butylamino]-2-oxoethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[9-[2-[4-(4-aminodithiolan-4-yl)butylamino]-2-oxoethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]acetate |
|---|---|
| PubChem CID | 160965758 |
| Molecular Formula | C22H33N3O9S2 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[9-[2-[4-(4-aminodithiolan-4-yl)butylamino]-2-oxoethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]acetate |
| SMILES | NC1(CCCCNC(=O)CC2OCC3(CO2)COC(CC(=O)ON2C(=O)CCC2=O)OC3)CSSC1 |
| InChI | InChI=1S/C22H33N3O9S2/c23-22(13-35-36-14-22)5-1-2-6-24-15(26)7-19-30-9-21(10-31-19)11-32-20(33-12-21)8-18(29)34-25-16(27)3-4-17(25)28/h19-20H,1-14,23H2,(H,24,26) |
| InChIKey | BVDZRIQPPFDUIM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 155.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|