About formazan;nonane
formazan;nonane (PubChem CID 160965853) has the molecular formula C11H28N8
and a molecular weight of 272.40 g/mol. Its IUPAC name is formazan;nonane.
Molecular Properties
| Compound Name | formazan;nonane |
| PubChem CID | 160965853 |
| Molecular Formula | C11H28N8 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | formazan;nonane |
| SMILES | CCCCCCCCC.[H]/N=N/C=NN.[H]/N=N/C=NN |
| InChI | InChI=1S/C9H20.2CH4N4/c1-3-5-7-9-8-6-4-2;2*2-4-1-5-3/h3-9H2,1-2H3;2*1-2H,3H2/b;2*4-2+,5-1? |
| InChIKey | SXPMVHJSLAFSMR-KIYSNALSSA-N |
| XLogP | 3.60 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze formazan;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formazan;nonane?
The IUPAC name of formazan;nonane (CID 160965853) is formazan;nonane.
What is the SMILES notation for formazan;nonane?
The canonical SMILES for formazan;nonane is CCCCCCCCC.[H]/N=N/C=NN.[H]/N=N/C=NN.
What is the InChIKey of formazan;nonane?
The InChIKey is SXPMVHJSLAFSMR-KIYSNALSSA-N. The full InChI is InChI=1S/C9H20.2CH4N4/c1-3-5-7-9-8-6-4-2;2*2-4-1-5-3/h3-9H2,1-2H3;2*1-2H,3H2/b;2*4-2+,5-1?.
What are the key properties of formazan;nonane?
formazan;nonane has a molecular weight of 272.40 g/mol, XLogP of 3.60, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formazan;nonane is sourced from PubChem (CID 160965853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).