C27H25ClFNO4S — CID 160965888
1-[(2S)-6-(2-chloro-3-fluorophenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]hex-5-en-3-one (PubChem CID 160965888) has the molecular formula C27H25ClFNO4S and a molecular weight of 514.02 g/mol. Its IUPAC name is 1-[(2S)-6-(2-chloro-3-fluorophenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]hex-5-en-3-one.
| Compound Name | 1-[(2S)-6-(2-chloro-3-fluorophenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]hex-5-en-3-one |
|---|---|
| PubChem CID | 160965888 |
| Molecular Formula | C27H25ClFNO4S |
| Molecular Weight | 514.02 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 1-[(2S)-6-(2-chloro-3-fluorophenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]hex-5-en-3-one |
| SMILES | C=CCC(=O)CC[C@H]1CN(S(=O)(=O)c2cccc(C)c2)c2cc(-c3cccc(F)c3Cl)ccc2O1 |
| InChI | InChI=1S/C27H25ClFNO4S/c1-3-6-20(31)12-13-21-17-30(35(32,33)22-8-4-7-18(2)15-22)25-16-19(11-14-26(25)34-21)23-9-5-10-24(29)27(23)28/h3-5,7-11,14-16,21H,1,6,12-13,17H2,2H3/t21-/m0/s1 |
| InChIKey | SXPPRCGHRLQGOF-NRFANRHFSA-N |
| XLogP | 6.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.02 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|