About 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide
2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide (PubChem CID 160965894) has the molecular formula C8H10F3N3O
and a molecular weight of 221.18 g/mol. Its IUPAC name is 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide |
| PubChem CID | 160965894 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccnn1C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O/c1-5(8(9,10)11)13-7(15)6-3-4-12-14(6)2/h3-5H,1-2H3,(H,13,15)/t5-/m0/s1 |
| InChIKey | SXPQBZJQPKEQSF-YFKPBYRVSA-N |
| XLogP | 1.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide?
The IUPAC name of 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide (CID 160965894) is 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide.
What is the SMILES notation for 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide?
The canonical SMILES for 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide is C[C@H](NC(=O)c1ccnn1C)C(F)(F)F.
What is the InChIKey of 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide?
The InChIKey is SXPQBZJQPKEQSF-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H10F3N3O/c1-5(8(9,10)11)13-7(15)6-3-4-12-14(6)2/h3-5H,1-2H3,(H,13,15)/t5-/m0/s1.
What are the key properties of 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide?
2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide has a molecular weight of 221.18 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyrazole-3-carboxamide is sourced from PubChem (CID 160965894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).