C21H27F3NO4- — CID 160966232
ethane;N-ethyl-2-[2-(4-methylphenoxy)ethoxy]aniline;2,2,2-trifluoroacetate (PubChem CID 160966232) has the molecular formula C21H27F3NO4- and a molecular weight of 414.44 g/mol. Its IUPAC name is ethane;N-ethyl-2-[2-(4-methylphenoxy)ethoxy]aniline;2,2,2-trifluoroacetate.
| Compound Name | ethane;N-ethyl-2-[2-(4-methylphenoxy)ethoxy]aniline;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160966232 |
| Molecular Formula | C21H27F3NO4- |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | ethane;N-ethyl-2-[2-(4-methylphenoxy)ethoxy]aniline;2,2,2-trifluoroacetate |
| SMILES | CC.CCNc1ccccc1OCCOc1ccc(C)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C17H21NO2.C2HF3O2.C2H6/c1-3-18-16-6-4-5-7-17(16)20-13-12-19-15-10-8-14(2)9-11-15;3-2(4,5)1(6)7;1-2/h4-11,18H,3,12-13H2,1-2H3;(H,6,7);1-2H3/p-1 |
| InChIKey | FOOWDYADKSWFBK-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|