About acetamide;1H-imidazol-3-ium;chloride
acetamide;1H-imidazol-3-ium;chloride (PubChem CID 160967651) has the molecular formula C5H10ClN3O
and a molecular weight of 163.61 g/mol. Its IUPAC name is acetamide;1H-imidazol-3-ium;chloride.
Molecular Properties
| Compound Name | acetamide;1H-imidazol-3-ium;chloride |
| PubChem CID | 160967651 |
| Molecular Formula | C5H10ClN3O |
| Molecular Weight | 163.61 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | acetamide;1H-imidazol-3-ium;chloride |
| SMILES | CC(N)=O.[Cl-].c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C3H4N2.C2H5NO.ClH/c1-2-5-3-4-1;1-2(3)4;/h1-3H,(H,4,5);1H3,(H2,3,4);1H |
| InChIKey | DABRSBSEVMKBJY-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.61 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetamide;1H-imidazol-3-ium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;1H-imidazol-3-ium;chloride?
The IUPAC name of acetamide;1H-imidazol-3-ium;chloride (CID 160967651) is acetamide;1H-imidazol-3-ium;chloride.
What is the SMILES notation for acetamide;1H-imidazol-3-ium;chloride?
The canonical SMILES for acetamide;1H-imidazol-3-ium;chloride is CC(N)=O.[Cl-].c1c[nH+]c[nH]1.
What is the InChIKey of acetamide;1H-imidazol-3-ium;chloride?
The InChIKey is DABRSBSEVMKBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2H5NO.ClH/c1-2-5-3-4-1;1-2(3)4;/h1-3H,(H,4,5);1H3,(H2,3,4);1H.
What are the key properties of acetamide;1H-imidazol-3-ium;chloride?
acetamide;1H-imidazol-3-ium;chloride has a molecular weight of 163.61 g/mol, XLogP of -3.68, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;1H-imidazol-3-ium;chloride is sourced from PubChem (CID 160967651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).