C8H9F11O2 — CID 160967875
3-ethenoxy-1,1,1-trifluoropropane;molecular fluorine;1,1,3,3,3-pentafluoropropyl hypofluorite (PubChem CID 160967875) has the molecular formula C8H9F11O2 and a molecular weight of 346.14 g/mol. Its IUPAC name is 3-ethenoxy-1,1,1-trifluoropropane;molecular fluorine;1,1,3,3,3-pentafluoropropyl hypofluorite.
| Compound Name | 3-ethenoxy-1,1,1-trifluoropropane;molecular fluorine;1,1,3,3,3-pentafluoropropyl hypofluorite |
|---|---|
| PubChem CID | 160967875 |
| Molecular Formula | C8H9F11O2 |
| Molecular Weight | 346.14 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-ethenoxy-1,1,1-trifluoropropane;molecular fluorine;1,1,3,3,3-pentafluoropropyl hypofluorite |
| SMILES | C=COCCC(F)(F)F.FF.FOC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C5H7F3O.C3H2F6O.F2/c1-2-9-4-3-5(6,7)8;4-2(5,6)1-3(7,8)10-9;1-2/h2H,1,3-4H2;1H2; |
| InChIKey | SXWBEWMSWKNRDS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.14 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|