C38H48Br2N6O4 — CID 160968469
(2,6-dimethylcyclohexyl) 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 160968469) has the molecular formula C38H48Br2N6O4 and a molecular weight of 812.65 g/mol. Its IUPAC name is (2,6-dimethylcyclohexyl) 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate.
| Compound Name | (2,6-dimethylcyclohexyl) 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate |
|---|---|
| PubChem CID | 160968469 |
| Molecular Formula | C38H48Br2N6O4 |
| Molecular Weight | 812.65 g/mol |
| Exact Mass | 810.21 |
| IUPAC Name | (2,6-dimethylcyclohexyl) 2-bromo-2-[3-(4-methylphenyl)-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | Cc1ccc(-c2n[nH]c(C(Br)C(=O)OC3C(C)CCCC3C)n2)cc1.Cc1ccc(-c2n[nH]c(C(Br)C(=O)OC3C(C)CCCC3C)n2)cc1 |
| InChI | InChI=1S/2C19H24BrN3O2/c2*1-11-7-9-14(10-8-11)17-21-18(23-22-17)15(20)19(24)25-16-12(2)5-4-6-13(16)3/h2*7-10,12-13,15-16H,4-6H2,1-3H3,(H,21,22,23) |
| InChIKey | SXXZRUTYCHRGOR-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.65 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|