C8H6F9NO3 — CID 160969301
1-hydroxypyrrolidine-2,5-dione;1,1,1,2,2,3,3,4,4-nonafluorobutane (PubChem CID 160969301) has the molecular formula C8H6F9NO3 and a molecular weight of 335.12 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;1,1,1,2,2,3,3,4,4-nonafluorobutane.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;1,1,1,2,2,3,3,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 160969301 |
| Molecular Formula | C8H6F9NO3 |
| Molecular Weight | 335.12 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;1,1,1,2,2,3,3,4,4-nonafluorobutane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)F.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4HF9.C4H5NO3/c5-1(6)2(7,8)3(9,10)4(11,12)13;6-3-1-2-4(7)5(3)8/h1H;8H,1-2H2 |
| InChIKey | SYAYONPBXLHIFQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|