C33H36F3N3O9 — CID 160972080
ethyl 5,5-difluoro-4-oxo-6,7-dihydro-1H-indole-2-carboxylate;ethyl 5-fluoro-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate;ethyl 4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate (PubChem CID 160972080) has the molecular formula C33H36F3N3O9 and a molecular weight of 675.66 g/mol. Its IUPAC name is ethyl 5,5-difluoro-4-oxo-6,7-dihydro-1H-indole-2-carboxylate;ethyl 5-fluoro-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate;ethyl 4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate.
| Compound Name | ethyl 5,5-difluoro-4-oxo-6,7-dihydro-1H-indole-2-carboxylate;ethyl 5-fluoro-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate;ethyl 4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 160972080 |
| Molecular Formula | C33H36F3N3O9 |
| Molecular Weight | 675.66 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | ethyl 5,5-difluoro-4-oxo-6,7-dihydro-1H-indole-2-carboxylate;ethyl 5-fluoro-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate;ethyl 4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c([nH]1)CCC(F)(F)C2=O.CCOC(=O)c1cc2c([nH]1)CCC(F)C2=O.CCOC(=O)c1cc2c([nH]1)CCCC2=O |
| InChI | InChI=1S/C11H11F2NO3.C11H12FNO3.C11H13NO3/c1-2-17-10(16)8-5-6-7(14-8)3-4-11(12,13)9(6)15;1-2-16-11(15)9-5-6-8(13-9)4-3-7(12)10(6)14;1-2-15-11(14)9-6-7-8(12-9)4-3-5-10(7)13/h5,14H,2-4H2,1H3;5,7,13H,2-4H2,1H3;6,12H,2-5H2,1H3 |
| InChIKey | SYJVCSWMEOXGRL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 177.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|