C20H31NO7S — CID 160972485
3-[4-[3-(2,4-dioxopentan-3-ylsulfonyl)butyl]anilino]-3-oxopropanoic acid;methane (PubChem CID 160972485) has the molecular formula C20H31NO7S and a molecular weight of 429.54 g/mol. Its IUPAC name is 3-[4-[3-(2,4-dioxopentan-3-ylsulfonyl)butyl]anilino]-3-oxopropanoic acid;methane.
| Compound Name | 3-[4-[3-(2,4-dioxopentan-3-ylsulfonyl)butyl]anilino]-3-oxopropanoic acid;methane |
|---|---|
| PubChem CID | 160972485 |
| Molecular Formula | C20H31NO7S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 3-[4-[3-(2,4-dioxopentan-3-ylsulfonyl)butyl]anilino]-3-oxopropanoic acid;methane |
| SMILES | C.C.CC(=O)C(C(C)=O)S(=O)(=O)C(C)CCc1ccc(NC(=O)CC(=O)O)cc1 |
| InChI | InChI=1S/C18H23NO7S.2CH4/c1-11(27(25,26)18(12(2)20)13(3)21)4-5-14-6-8-15(9-7-14)19-16(22)10-17(23)24;;/h6-9,11,18H,4-5,10H2,1-3H3,(H,19,22)(H,23,24);2*1H4 |
| InChIKey | SYLBUBUMHMTUMG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|