About methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate
methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate (PubChem CID 160973507) has the molecular formula C17H12BrCl2NO4
and a molecular weight of 445.10 g/mol. Its IUPAC name is methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate.
Molecular Properties
| Compound Name | methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate |
| PubChem CID | 160973507 |
| Molecular Formula | C17H12BrCl2NO4 |
| Molecular Weight | 445.10 g/mol |
| Exact Mass | 442.93 |
| IUPAC Name | methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1Br.COC(=O)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C9H6ClNO2.C8H6BrClO2/c1-13-9(12)8-4-7(10)3-2-6(8)5-11;1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4H,1H3;2-4H,1H3 |
| InChIKey | SYOGPRHAKLNGQI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.10 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate?
The IUPAC name of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate (CID 160973507) is methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate.
What is the SMILES notation for methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate?
The canonical SMILES for methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate is COC(=O)c1cc(Cl)ccc1Br.COC(=O)c1cc(Cl)ccc1C#N.
What is the InChIKey of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate?
The InChIKey is SYOGPRHAKLNGQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2.C8H6BrClO2/c1-13-9(12)8-4-7(10)3-2-6(8)5-11;1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4H,1H3;2-4H,1H3.
What are the key properties of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate?
methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate has a molecular weight of 445.10 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-cyanobenzoate is sourced from PubChem (CID 160973507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).