About piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone
piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone (PubChem CID 160973908) has the molecular formula C10H19F3N4O
and a molecular weight of 268.28 g/mol. Its IUPAC name is piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone.
Molecular Properties
| Compound Name | piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone |
| PubChem CID | 160973908 |
| Molecular Formula | C10H19F3N4O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone |
| SMILES | C1CNCCN1.O=C(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O.C4H10N2/c7-6(8,9)5(12)11-3-1-10-2-4-11;1-2-6-4-3-5-1/h10H,1-4H2;5-6H,1-4H2 |
| InChIKey | SYPOSHUCJSYZKY-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone?
The IUPAC name of piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone (CID 160973908) is piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone.
What is the SMILES notation for piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone?
The canonical SMILES for piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone is C1CNCCN1.O=C(N1CCNCC1)C(F)(F)F.
What is the InChIKey of piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone?
The InChIKey is SYPOSHUCJSYZKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3N2O.C4H10N2/c7-6(8,9)5(12)11-3-1-10-2-4-11;1-2-6-4-3-5-1/h10H,1-4H2;5-6H,1-4H2.
What are the key properties of piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone?
piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone has a molecular weight of 268.28 g/mol, XLogP of -0.84, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;2,2,2-trifluoro-1-piperazin-1-ylethanone is sourced from PubChem (CID 160973908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).