C24H26N2O2 — CID 160974546
2-cyclobutylidene-N-phenylacetamide;spiro[1,3-dihydroquinoline-4,1'-cyclobutane]-2-one (PubChem CID 160974546) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-cyclobutylidene-N-phenylacetamide;spiro[1,3-dihydroquinoline-4,1'-cyclobutane]-2-one.
| Compound Name | 2-cyclobutylidene-N-phenylacetamide;spiro[1,3-dihydroquinoline-4,1'-cyclobutane]-2-one |
|---|---|
| PubChem CID | 160974546 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-cyclobutylidene-N-phenylacetamide;spiro[1,3-dihydroquinoline-4,1'-cyclobutane]-2-one |
| SMILES | O=C(C=C1CCC1)Nc1ccccc1.O=C1CC2(CCC2)c2ccccc2N1 |
| InChI | InChI=1S/2C12H13NO/c14-11-8-12(6-3-7-12)9-4-1-2-5-10(9)13-11;14-12(9-10-5-4-6-10)13-11-7-2-1-3-8-11/h1-2,4-5H,3,6-8H2,(H,13,14);1-3,7-9H,4-6H2,(H,13,14) |
| InChIKey | SYRPAHGJCANZBW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|