C24H31NO5 — CID 160975170
2-deuterio-2-methylpropanenitrile;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 160975170) has the molecular formula C24H31NO5 and a molecular weight of 414.52 g/mol. Its IUPAC name is 2-deuterio-2-methylpropanenitrile;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | 2-deuterio-2-methylpropanenitrile;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 160975170 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-deuterio-2-methylpropanenitrile;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione;1,3,4,6-tetramethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | CC1=C(C)C(=O)C(C)=C(C)C1=O.CC1=C(C)C(=O)C2(C)OC2(C)C1=O.[2H]C(C)(C)C#N |
| InChI | InChI=1S/C10H12O3.C10H12O2.C4H7N/c1-5-6(2)8(12)10(4)9(3,13-10)7(5)11;1-5-6(2)10(12)8(4)7(3)9(5)11;1-4(2)3-5/h1-4H3;1-4H3;4H,1-2H3/i;;4D |
| InChIKey | SYTOHIGRYSYMCD-SHKFFRSUSA-N |
| XLogP | 4.00 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|