About ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one
ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one (PubChem CID 160975514) has the molecular formula C22H18O9
and a molecular weight of 426.38 g/mol. Its IUPAC name is ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one.
Molecular Properties
| Compound Name | ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one |
| PubChem CID | 160975514 |
| Molecular Formula | C22H18O9 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one |
| SMILES | CCOC(=O)c1cc(=O)c2ccc(O)cc2o1.O=c1cc(CO)oc2cc(O)ccc12 |
| InChI | InChI=1S/C12H10O5.C10H8O4/c1-2-16-12(15)11-6-9(14)8-4-3-7(13)5-10(8)17-11;11-5-7-4-9(13)8-2-1-6(12)3-10(8)14-7/h3-6,13H,2H2,1H3;1-4,11-12H,5H2 |
| InChIKey | SYUSXYOYJYFURB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one?
The IUPAC name of ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one (CID 160975514) is ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one.
What is the SMILES notation for ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one?
The canonical SMILES for ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one is CCOC(=O)c1cc(=O)c2ccc(O)cc2o1.O=c1cc(CO)oc2cc(O)ccc12.
What is the InChIKey of ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one?
The InChIKey is SYUSXYOYJYFURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O5.C10H8O4/c1-2-16-12(15)11-6-9(14)8-4-3-7(13)5-10(8)17-11;11-5-7-4-9(13)8-2-1-6(12)3-10(8)14-7/h3-6,13H,2H2,1H3;1-4,11-12H,5H2.
What are the key properties of ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one?
ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one has a molecular weight of 426.38 g/mol, XLogP of 2.67, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-hydroxy-4-oxochromene-2-carboxylate;7-hydroxy-2-(hydroxymethyl)chromen-4-one is sourced from PubChem (CID 160975514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).