C19H17FO4 — CID 160976408
1-(4-fluorophenyl)-5-(3-methoxy-2-methylphenyl)pentane-1,3,4-trione (PubChem CID 160976408) has the molecular formula C19H17FO4 and a molecular weight of 328.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-(3-methoxy-2-methylphenyl)pentane-1,3,4-trione.
| Compound Name | 1-(4-fluorophenyl)-5-(3-methoxy-2-methylphenyl)pentane-1,3,4-trione |
|---|---|
| PubChem CID | 160976408 |
| Molecular Formula | C19H17FO4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(4-fluorophenyl)-5-(3-methoxy-2-methylphenyl)pentane-1,3,4-trione |
| SMILES | COc1cccc(CC(=O)C(=O)CC(=O)c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C19H17FO4/c1-12-14(4-3-5-19(12)24-2)10-17(22)18(23)11-16(21)13-6-8-15(20)9-7-13/h3-9H,10-11H2,1-2H3 |
| InChIKey | SYXUWJNJOGYHTL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|