C20H24F2N2O4 — CID 160976441
5-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol;7-fluoro-5-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol (PubChem CID 160976441) has the molecular formula C20H24F2N2O4 and a molecular weight of 394.42 g/mol. Its IUPAC name is 5-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol;7-fluoro-5-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol.
| Compound Name | 5-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol;7-fluoro-5-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol |
|---|---|
| PubChem CID | 160976441 |
| Molecular Formula | C20H24F2N2O4 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 5-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol;7-fluoro-5-methoxy-1,2,3,4-tetrahydroisoquinolin-4-ol |
| SMILES | COc1cc(F)c2c(c1)CNCC2O.COc1cc(F)cc2c1C(O)CNC2 |
| InChI | InChI=1S/2C10H12FNO2/c1-14-9-3-7(11)2-6-4-12-5-8(13)10(6)9;1-14-7-2-6-4-12-5-9(13)10(6)8(11)3-7/h2-3,8,12-13H,4-5H2,1H3;2-3,9,12-13H,4-5H2,1H3 |
| InChIKey | SYXYBCBDWWOPGI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |