About [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate
[3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate (PubChem CID 160977500) has the molecular formula C20H25FN2O2
and a molecular weight of 344.43 g/mol. Its IUPAC name is [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate.
Molecular Properties
| Compound Name | [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate |
| PubChem CID | 160977500 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate |
| SMILES | CC(C)(C)C(CC(OC(N)=O)c1ccc(F)cc1)c1cccc(N)c1 |
| InChI | InChI=1S/C20H25FN2O2/c1-20(2,3)17(14-5-4-6-16(22)11-14)12-18(25-19(23)24)13-7-9-15(21)10-8-13/h4-11,17-18H,12,22H2,1-3H3,(H2,23,24) |
| InChIKey | SZBJMSYEXROPRK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate?
The IUPAC name of [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate (CID 160977500) is [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate.
What is the SMILES notation for [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate?
The canonical SMILES for [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate is CC(C)(C)C(CC(OC(N)=O)c1ccc(F)cc1)c1cccc(N)c1.
What is the InChIKey of [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate?
The InChIKey is SZBJMSYEXROPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN2O2/c1-20(2,3)17(14-5-4-6-16(22)11-14)12-18(25-19(23)24)13-7-9-15(21)10-8-13/h4-11,17-18H,12,22H2,1-3H3,(H2,23,24).
What are the key properties of [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate?
[3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate has a molecular weight of 344.43 g/mol, XLogP of 4.76, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-aminophenyl)-1-(4-fluorophenyl)-4,4-dimethylpentyl] carbamate is sourced from PubChem (CID 160977500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).