C13H26O6 — CID 160979540
2,2-bis(hydroxymethyl)propane-1,3-diol;pentyl prop-2-enoate (PubChem CID 160979540) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;pentyl prop-2-enoate.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;pentyl prop-2-enoate |
|---|---|
| PubChem CID | 160979540 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC.OCC(CO)(CO)CO |
| InChI | InChI=1S/C8H14O2.C5H12O4/c1-3-5-6-7-10-8(9)4-2;6-1-5(2-7,3-8)4-9/h4H,2-3,5-7H2,1H3;6-9H,1-4H2 |
| InChIKey | SZIFLUZQBRQQPG-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|