C15H25N — CID 160981483
5-tert-butyl-5-propan-2-yl-1,4,6,7-tetrahydroisoindole (PubChem CID 160981483) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 5-tert-butyl-5-propan-2-yl-1,4,6,7-tetrahydroisoindole.
| Compound Name | 5-tert-butyl-5-propan-2-yl-1,4,6,7-tetrahydroisoindole |
|---|---|
| PubChem CID | 160981483 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 5-tert-butyl-5-propan-2-yl-1,4,6,7-tetrahydroisoindole |
| SMILES | CC(C)C1(C(C)(C)C)CCC2=C(C=NC2)C1 |
| InChI | InChI=1S/C15H25N/c1-11(2)15(14(3,4)5)7-6-12-9-16-10-13(12)8-15/h10-11H,6-9H2,1-5H3 |
| InChIKey | ZJWHOKWAJIRHHH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |