C14H17N4O2+ — CID 160983131
3-[(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)methyl]-5-(methoxymethyl)-1,2,4-oxadiazole (PubChem CID 160983131) has the molecular formula C14H17N4O2+ and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-[(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)methyl]-5-(methoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)methyl]-5-(methoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 160983131 |
| Molecular Formula | C14H17N4O2+ |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-[(5,6-dimethyl-3H-benzimidazol-1-ium-1-yl)methyl]-5-(methoxymethyl)-1,2,4-oxadiazole |
| SMILES | COCc1nc(C[n+]2c[nH]c3cc(C)c(C)cc32)no1 |
| InChI | InChI=1S/C14H16N4O2/c1-9-4-11-12(5-10(9)2)18(8-15-11)6-13-16-14(7-19-3)20-17-13/h4-5,8H,6-7H2,1-3H3/p+1 |
| InChIKey | SZTUAPRDCPGLBH-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 67.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|