C29H29ClFN7O2S — CID 160984673
[(4aS,6S)-6-[ethyl-[methylidene-(1-methyl-1,2,4-triazol-3-yl)-oxo-λ6-sulfanyl]amino]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-chloro-2-pyridinyl)methanone (PubChem CID 160984673) has the molecular formula C29H29ClFN7O2S and a molecular weight of 594.12 g/mol. Its IUPAC name is [(4aS,6S)-6-[ethyl-[methylidene-(1-methyl-1,2,4-triazol-3-yl)-oxo-λ6-sulfanyl]amino]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-chloro-2-pyridinyl)methanone.
| Compound Name | [(4aS,6S)-6-[ethyl-[methylidene-(1-methyl-1,2,4-triazol-3-yl)-oxo-λ6-sulfanyl]amino]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-chloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 160984673 |
| Molecular Formula | C29H29ClFN7O2S |
| Molecular Weight | 594.12 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | [(4aS,6S)-6-[ethyl-[methylidene-(1-methyl-1,2,4-triazol-3-yl)-oxo-λ6-sulfanyl]amino]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-4a-yl]-(4-chloro-2-pyridinyl)methanone |
| SMILES | C=S(=O)(c1ncn(C)n1)N(CC)[C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@]2(C(=O)c2cc(Cl)ccn2)C1 |
| InChI | InChI=1S/C29H29ClFN7O2S/c1-4-37(41(3,40)28-33-18-36(2)35-28)24-8-5-20-13-26-19(17-34-38(26)23-9-6-22(31)7-10-23)15-29(20,16-24)27(39)25-14-21(30)11-12-32-25/h6-7,9-14,17-18,24H,3-5,8,15-16H2,1-2H3/t24-,29-,41?/m0/s1 |
| InChIKey | XUZXYPFNIJQGAT-JLNHYVPZSA-N |
| XLogP | 4.56 |
| TPSA | 98.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.12 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|