C27H25F5N2O2 — CID 160985414
carbonyl difluoride;(3R,5R)-3-[2-methyl-2-[6-(trifluoromethyl)-2-pyridinyl]propyl]-1,5-diphenylpyrrolidin-2-one (PubChem CID 160985414) has the molecular formula C27H25F5N2O2 and a molecular weight of 504.50 g/mol. Its IUPAC name is carbonyl difluoride;(3R,5R)-3-[2-methyl-2-[6-(trifluoromethyl)-2-pyridinyl]propyl]-1,5-diphenylpyrrolidin-2-one.
| Compound Name | carbonyl difluoride;(3R,5R)-3-[2-methyl-2-[6-(trifluoromethyl)-2-pyridinyl]propyl]-1,5-diphenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 160985414 |
| Molecular Formula | C27H25F5N2O2 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | carbonyl difluoride;(3R,5R)-3-[2-methyl-2-[6-(trifluoromethyl)-2-pyridinyl]propyl]-1,5-diphenylpyrrolidin-2-one |
| SMILES | CC(C)(C[C@@H]1C[C@H](c2ccccc2)N(c2ccccc2)C1=O)c1cccc(C(F)(F)F)n1.O=C(F)F |
| InChI | InChI=1S/C26H25F3N2O.CF2O/c1-25(2,22-14-9-15-23(30-22)26(27,28)29)17-19-16-21(18-10-5-3-6-11-18)31(24(19)32)20-12-7-4-8-13-20;2-1(3)4/h3-15,19,21H,16-17H2,1-2H3;/t19-,21+;/m0./s1 |
| InChIKey | TTXGPQPMJIAEPP-LZAGWAHOSA-N |
| XLogP | 7.61 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|