C23H23N3O6S4 — CID 160985493
6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-4-one (PubChem CID 160985493) has the molecular formula C23H23N3O6S4 and a molecular weight of 565.72 g/mol. Its IUPAC name is 6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-4-one.
| Compound Name | 6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-4-one |
|---|---|
| PubChem CID | 160985493 |
| Molecular Formula | C23H23N3O6S4 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | 6-hydroxy-5-[7-(2-methylsulfonylethyl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-3-yl]-3-(thiophen-3-ylmethyl)-3-azatricyclo[6.2.1.02,7]undeca-5,9-dien-4-one |
| SMILES | CS(=O)(=O)CCc1csc2c1S(=O)(=O)N=C(C1=C(O)C3C4C=CC(C4)C3N(Cc3ccsc3)C1=O)N2 |
| InChI | InChI=1S/C23H23N3O6S4/c1-35(29,30)7-5-15-11-34-22-20(15)36(31,32)25-21(24-22)17-19(27)16-13-2-3-14(8-13)18(16)26(23(17)28)9-12-4-6-33-10-12/h2-4,6,10-11,13-14,16,18,27H,5,7-9H2,1H3,(H,24,25) |
| InChIKey | TTXMMZQYFPPAKU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|