C26H36B2F3N3O4 — CID 160985813
2-(3,3-difluoropyrrolidin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 160985813) has the molecular formula C26H36B2F3N3O4 and a molecular weight of 533.21 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 160985813 |
| Molecular Formula | C26H36B2F3N3O4 |
| Molecular Weight | 533.21 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ccnc(F)c2)OC1(C)C.CC1(C)OB(c2ccnc(N3CCC(F)(F)C3)c2)OC1(C)C |
| InChI | InChI=1S/C15H21BF2N2O2.C11H15BFNO2/c1-13(2)14(3,4)22-16(21-13)11-5-7-19-12(9-11)20-8-6-15(17,18)10-20;1-10(2)11(3,4)16-12(15-10)8-5-6-14-9(13)7-8/h5,7,9H,6,8,10H2,1-4H3;5-7H,1-4H3 |
| InChIKey | TTYPAQIQOIYFEL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|