About cyclopentanol;3-methyl-3-propan-2-yloxetane
cyclopentanol;3-methyl-3-propan-2-yloxetane (PubChem CID 160986666) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is cyclopentanol;3-methyl-3-propan-2-yloxetane.
Molecular Properties
| Compound Name | cyclopentanol;3-methyl-3-propan-2-yloxetane |
| PubChem CID | 160986666 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | cyclopentanol;3-methyl-3-propan-2-yloxetane |
| SMILES | CC(C)C1(C)COC1.OC1CCCC1 |
| InChI | InChI=1S/C7H14O.C5H10O/c1-6(2)7(3)4-8-5-7;6-5-3-1-2-4-5/h6H,4-5H2,1-3H3;5-6H,1-4H2 |
| InChIKey | TUBLGFKUGHUMKV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentanol;3-methyl-3-propan-2-yloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanol;3-methyl-3-propan-2-yloxetane?
The IUPAC name of cyclopentanol;3-methyl-3-propan-2-yloxetane (CID 160986666) is cyclopentanol;3-methyl-3-propan-2-yloxetane.
What is the SMILES notation for cyclopentanol;3-methyl-3-propan-2-yloxetane?
The canonical SMILES for cyclopentanol;3-methyl-3-propan-2-yloxetane is CC(C)C1(C)COC1.OC1CCCC1.
What is the InChIKey of cyclopentanol;3-methyl-3-propan-2-yloxetane?
The InChIKey is TUBLGFKUGHUMKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C5H10O/c1-6(2)7(3)4-8-5-7;6-5-3-1-2-4-5/h6H,4-5H2,1-3H3;5-6H,1-4H2.
What are the key properties of cyclopentanol;3-methyl-3-propan-2-yloxetane?
cyclopentanol;3-methyl-3-propan-2-yloxetane has a molecular weight of 200.32 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanol;3-methyl-3-propan-2-yloxetane is sourced from PubChem (CID 160986666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).