About CID 160987919
CID 160987919 (PubChem CID 160987919) has the molecular formula C2H9F
and a molecular weight of 58.12 g/mol.
Molecular Properties
| Compound Name | CID 160987919 |
| PubChem CID | 160987919 |
| Molecular Formula | C2H9F |
| Molecular Weight | 58.12 g/mol |
| Exact Mass | 58.10 |
| IUPAC Name | — |
| SMILES | [2H]C[2H].[2H]C[2H].[3H]F |
| InChI | InChI=1S/2CH4.FH/h2*1H4;1H/i2*1D2;/hT |
| InChIKey | TUFKXBSYCAKZAV-STBXISQFSA-N |
| XLogP | 1.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 3 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 58.12 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 160987919 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160987919?
The IUPAC name of CID 160987919 (CID 160987919) is not available.
What is the SMILES notation for CID 160987919?
The canonical SMILES for CID 160987919 is [2H]C[2H].[2H]C[2H].[3H]F.
What is the InChIKey of CID 160987919?
The InChIKey is TUFKXBSYCAKZAV-STBXISQFSA-N. The full InChI is InChI=1S/2CH4.FH/h2*1H4;1H/i2*1D2;/hT.
What are the key properties of CID 160987919?
CID 160987919 has a molecular weight of 58.12 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160987919 is sourced from PubChem (CID 160987919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).