C19H25NO2 — CID 160988082
ethyl 9-but-3-enyl-9-isocyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate (PubChem CID 160988082) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl 9-but-3-enyl-9-isocyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate.
| Compound Name | ethyl 9-but-3-enyl-9-isocyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate |
|---|---|
| PubChem CID | 160988082 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | ethyl 9-but-3-enyl-9-isocyano-3,4,5,8-tetrahydro-2H-benzo[7]annulene-4a-carboxylate |
| SMILES | [C-]#[N+]C1(CCC=C)CC=CCC2(C(=O)OCC)CCCC=C12 |
| InChI | InChI=1S/C19H25NO2/c1-4-6-14-19(20-3)15-10-9-13-18(17(21)22-5-2)12-8-7-11-16(18)19/h4,9-11H,1,5-8,12-15H2,2H3 |
| InChIKey | GOUSPZJKGYVGEU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|