About lithium;2-fluorobenzenesulfonate;trifluoroborane
lithium;2-fluorobenzenesulfonate;trifluoroborane (PubChem CID 160988464) has the molecular formula C6H4BF4LiO3S
and a molecular weight of 249.91 g/mol. Its IUPAC name is lithium;2-fluorobenzenesulfonate;trifluoroborane.
Molecular Properties
| Compound Name | lithium;2-fluorobenzenesulfonate;trifluoroborane |
| PubChem CID | 160988464 |
| Molecular Formula | C6H4BF4LiO3S |
| Molecular Weight | 249.91 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | lithium;2-fluorobenzenesulfonate;trifluoroborane |
| SMILES | FB(F)F.O=S(=O)([O-])c1ccccc1F.[Li+] |
| InChI | InChI=1S/C6H5FO3S.BF3.Li/c7-5-3-1-2-4-6(5)11(8,9)10;2-1(3)4;/h1-4H,(H,8,9,10);;/q;;+1/p-1 |
| InChIKey | IIJIIESJOLTQMU-UHFFFAOYSA-M |
| XLogP | -1.39 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.91 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;2-fluorobenzenesulfonate;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-fluorobenzenesulfonate;trifluoroborane?
The IUPAC name of lithium;2-fluorobenzenesulfonate;trifluoroborane (CID 160988464) is lithium;2-fluorobenzenesulfonate;trifluoroborane.
What is the SMILES notation for lithium;2-fluorobenzenesulfonate;trifluoroborane?
The canonical SMILES for lithium;2-fluorobenzenesulfonate;trifluoroborane is FB(F)F.O=S(=O)([O-])c1ccccc1F.[Li+].
What is the InChIKey of lithium;2-fluorobenzenesulfonate;trifluoroborane?
The InChIKey is IIJIIESJOLTQMU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5FO3S.BF3.Li/c7-5-3-1-2-4-6(5)11(8,9)10;2-1(3)4;/h1-4H,(H,8,9,10);;/q;;+1/p-1.
What are the key properties of lithium;2-fluorobenzenesulfonate;trifluoroborane?
lithium;2-fluorobenzenesulfonate;trifluoroborane has a molecular weight of 249.91 g/mol, XLogP of -1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-fluorobenzenesulfonate;trifluoroborane is sourced from PubChem (CID 160988464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).