C14H16Cl2F3N2O5+ — CID 160989047
2-[[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium;2,2,2-trifluoroacetic acid (PubChem CID 160989047) has the molecular formula C14H16Cl2F3N2O5+ and a molecular weight of 420.19 g/mol. Its IUPAC name is 2-[[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160989047 |
| Molecular Formula | C14H16Cl2F3N2O5+ |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-[[3-carboxy-1-(3,4-dichlorophenyl)propylidene]amino]oxyethylazanium;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[NH3+]CCON=C(CCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O3.C2HF3O2/c13-9-2-1-8(7-10(9)14)11(3-4-12(17)18)16-19-6-5-15;3-2(4,5)1(6)7/h1-2,7H,3-6,15H2,(H,17,18);(H,6,7)/p+1 |
| InChIKey | KQUAUCLYMJUBMV-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|