C25H29NO7 — CID 160989228
1-(2,3-dihydroxyphenyl)-9-[(4S)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]nonane-1,9-dione (PubChem CID 160989228) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-(2,3-dihydroxyphenyl)-9-[(4S)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]nonane-1,9-dione.
| Compound Name | 1-(2,3-dihydroxyphenyl)-9-[(4S)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]nonane-1,9-dione |
|---|---|
| PubChem CID | 160989228 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-(2,3-dihydroxyphenyl)-9-[(4S)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]nonane-1,9-dione |
| SMILES | CC1OC(c2cccc(O)c2O)=N[C@@H]1C(=O)CCCCCCCC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C25H29NO7/c1-15-22(26-25(33-15)17-10-8-14-21(30)24(17)32)19(28)12-6-4-2-3-5-11-18(27)16-9-7-13-20(29)23(16)31/h7-10,13-15,22,29-32H,2-6,11-12H2,1H3/t15?,22-/m0/s1 |
| InChIKey | TUJZMRQHSGCKMT-CEISFSOZSA-N |
| XLogP | 4.23 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|