C34H39BFN5O3 — CID 160989899
1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;10-(3-fluorophenyl)-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one (PubChem CID 160989899) has the molecular formula C34H39BFN5O3 and a molecular weight of 595.53 g/mol. Its IUPAC name is 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;10-(3-fluorophenyl)-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one.
| Compound Name | 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;10-(3-fluorophenyl)-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 160989899 |
| Molecular Formula | C34H39BFN5O3 |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;10-(3-fluorophenyl)-2,3,4,4a,5,7-hexahydro-1H-pyrazino[1,2-a][1,5]benzodiazepin-6-one |
| SMILES | CC1(C)OB(c2cnn(Cc3ccccc3)c2)OC1(C)C.O=C1CC2CNCCN2c2cc(-c3cccc(F)c3)ccc2N1 |
| InChI | InChI=1S/C18H18FN3O.C16H21BN2O2/c19-14-3-1-2-12(8-14)13-4-5-16-17(9-13)22-7-6-20-11-15(22)10-18(23)21-16;1-15(2)16(3,4)21-17(20-15)14-10-18-19(12-14)11-13-8-6-5-7-9-13/h1-5,8-9,15,20H,6-7,10-11H2,(H,21,23);5-10,12H,11H2,1-4H3 |
| InChIKey | TUMCEFAILQSDAY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|